Products 2901109-94-0
CAS 2901109-94-0 is the registry number for 1-(2,3-Dichloropyridin-4-yl)cyclopentan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,3-dichloro-4-pyridinyl)cyclopentan-1-ol (CAS 2901109-94-0) is a chemical compound with the molecular formula C10H11Cl2NO and a molecular weight of 232.10 g/mol. IUPAC name: 1-(2,3-dichloro-4-pyridinyl)cyclopentan-1-ol. InChIKey: BTEVRVUKRAJVFI-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO |
|---|---|
| Molecular weight | 232.10 g/mol |
| IUPAC name | 1-(2,3-dichloro-4-pyridinyl)cyclopentan-1-ol |
| InChIKey | BTEVRVUKRAJVFI-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=C(C(=NC=C2)Cl)Cl)O |
Computed by PubChem (NCBI)