Products 29048-57-5
CAS 29048-57-5 is the registry number for 2-(2-acetyl-5-methoxyphenoxy)acetic acid, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-(2-acetyl-5-methoxyphenoxy)acetic acid (CAS 29048-57-5) is a chemical compound with the molecular formula C11H12O5 and a molecular weight of 224.21 g/mol. IUPAC name: 2-(2-acetyl-5-methoxyphenoxy)acetic acid. InChIKey: DJPUGKVFRDJSMK-UHFFFAOYSA-N.
| Molecular formula | C11H12O5 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 2-(2-acetyl-5-methoxyphenoxy)acetic acid |
| InChIKey | DJPUGKVFRDJSMK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)OC)OCC(=O)O |
Computed by PubChem (NCBI)