CAS 2905-29-5 appears in our catalog under these names: 2,6-Dimethylbenzenesulfonyl Chloride, 2,6–Dimethylbenzene–1–sulfonyl chloride, 2,6-Dimethylbenzene-1-sulfonyl chloride 95%, 2,6-Dimethylbenzene-1-sulfonyl chloride, 95%. Offered by: TRC, GLPBio, Ambeed, Fluorochem. Available pack sizes: 2,5g, 100mg, 1g, 250mg.
2,6-dimethylbenzenesulfonyl chloride (CAS 2905-29-5) is a chemical compound with the molecular formula C8H9ClO2S and a molecular weight of 204.67 g/mol. IUPAC name: 2,6-dimethylbenzenesulfonyl chloride. InChIKey: FKRXAOXJRNLGQK-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO2S |
|---|---|
| Molecular weight | 204.67 g/mol |
| IUPAC name | 2,6-dimethylbenzenesulfonyl chloride |
| InChIKey | FKRXAOXJRNLGQK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)