Products 2905-54-6
CAS 2905-54-6 appears in our catalog under these names: Methyl 2,3-dichlorobenzoate, >95% (HPLC), Methyl 2,3-dichlorobenzoate, 2,3-Dichlorobenzoic acid methyl ester 95%, Methyl 2,3-dichlorobenzoate, 95%, 95%, Methyl 2,3-dichlorobenzoate, 95%. Offered by: TRC, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 250g, 500g, 1000g, 5g, 10g, 25g.
Methyl 2,3-dichlorobenzoate (CAS 2905-54-6) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: methyl 2,3-dichlorobenzoate. InChIKey: RFVULUSGHFRDHJ-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | methyl 2,3-dichlorobenzoate |
| InChIKey | RFVULUSGHFRDHJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)