CAS 2913226-33-0 is the registry number for (1R)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1R)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 2913226-33-0) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: (1R)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: DXTXXJLZWGNMLO-RFVHGSKJSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | (1R)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | DXTXXJLZWGNMLO-RFVHGSKJSA-N |
| SMILES | CN[C@@H]1CCCC2=CC=CC=C12.Cl |
Computed by PubChem (NCBI)