Products 2916371-59-8
CAS 2916371-59-8 appears in our catalog under these names: Cisd2 agonist 2, Cisd2 agonist 2, 98%, 98%, Cisd2 agonist 2, 99.17%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 10 mg, 10mM/1mL, 5 mg.
Methyl 2-amino-5-[(4-hydroxyphenyl)carbamoyl]-4-methylthiophene-3-carboxylate (CAS 2916371-59-8) is a chemical compound with the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. IUPAC name: methyl 2-amino-5-[(4-hydroxyphenyl)carbamoyl]-4-methylthiophene-3-carboxylate. InChIKey: RUKNSHPYDAPFMK-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O4S |
|---|---|
| Molecular weight | 306.34 g/mol |
| IUPAC name | methyl 2-amino-5-[(4-hydroxyphenyl)carbamoyl]-4-methylthiophene-3-carboxylate |
| InChIKey | RUKNSHPYDAPFMK-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=C1C(=O)OC)N)C(=O)NC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)