CAS 351003-03-7 appears in our catalog under these names: 3-(6-CHLORO-2H-1,4-BENZOXAZIN-3(4H)-ONE-4-YL)PROPIONIC ACID, 98%, 98%, 3-(6-Chloro-2H-1,4-benzoxazin-3(4H)-one-4-yl)-propionic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
3-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)propanoic acid (CAS 351003-03-7) is a chemical compound with the molecular formula C11H10ClNO4 and a molecular weight of 255.65 g/mol. IUPAC name: 3-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)propanoic acid. InChIKey: REQQIWCFXWGLDY-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO4 |
|---|---|
| Molecular weight | 255.65 g/mol |
| IUPAC name | 3-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)propanoic acid |
| InChIKey | REQQIWCFXWGLDY-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C2=C(O1)C=CC(=C2)Cl)CCC(=O)O |
Computed by PubChem (NCBI)