Products 2918263-09-7
CAS 2918263-09-7 is the registry number for LBA-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-hydroxy-2-[2-(4-phenylphenyl)ethyl]butanedioic acid (CAS 2918263-09-7) is a chemical compound with the molecular formula C18H18O5 and a molecular weight of 314.3 g/mol. IUPAC name: 2-hydroxy-2-[2-(4-phenylphenyl)ethyl]butanedioic acid. InChIKey: PQWDAACWHGFWSH-UHFFFAOYSA-N.
| Molecular formula | C18H18O5 |
|---|---|
| Molecular weight | 314.3 g/mol |
| IUPAC name | 2-hydroxy-2-[2-(4-phenylphenyl)ethyl]butanedioic acid |
| InChIKey | PQWDAACWHGFWSH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CCC(CC(=O)O)(C(=O)O)O |
Computed by PubChem (NCBI)