Products 2918343-00-5
CAS 2918343-00-5 is the registry number for Methyl 5-formyl-2,3-dihydro-1H-indene-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-formyl-2,3-dihydro-1H-indene-2-carboxylate (CAS 2918343-00-5) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: methyl 5-formyl-2,3-dihydro-1H-indene-2-carboxylate. InChIKey: AHESZNHYCUOUCV-UHFFFAOYSA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | methyl 5-formyl-2,3-dihydro-1H-indene-2-carboxylate |
| InChIKey | AHESZNHYCUOUCV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2=C(C1)C=C(C=C2)C=O |
Computed by PubChem (NCBI)