Products 2918779-76-5
CAS 2918779-76-5 is the registry number for (3-Bromophenyl)(cyclopropyl)methanamine hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(3-bromophenyl)-cyclopropylmethanamine;hydrochloride (CAS 2918779-76-5) is a chemical compound with the molecular formula C10H13BrClN and a molecular weight of 262.57 g/mol. IUPAC name: (3-bromophenyl)-cyclopropylmethanamine;hydrochloride. InChIKey: CWSALKKLUXNOJR-UHFFFAOYSA-N.
| Molecular formula | C10H13BrClN |
|---|---|
| Molecular weight | 262.57 g/mol |
| IUPAC name | (3-bromophenyl)-cyclopropylmethanamine;hydrochloride |
| InChIKey | CWSALKKLUXNOJR-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=CC(=CC=C2)Br)N.Cl |
Computed by PubChem (NCBI)