Products 2918836-31-2
CAS 2918836-31-2 is the registry number for 2-(2-Chloro-4-fluorophenyl)-2-methyl-1,3-dioxolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2-chloro-4-fluorophenyl)-2-methyl-1,3-dioxolane (CAS 2918836-31-2) is a chemical compound with the molecular formula C10H10ClFO2 and a molecular weight of 216.63 g/mol. IUPAC name: 2-(2-chloro-4-fluorophenyl)-2-methyl-1,3-dioxolane. InChIKey: VJQZVJTVPGPAQW-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFO2 |
|---|---|
| Molecular weight | 216.63 g/mol |
| IUPAC name | 2-(2-chloro-4-fluorophenyl)-2-methyl-1,3-dioxolane |
| InChIKey | VJQZVJTVPGPAQW-UHFFFAOYSA-N |
| SMILES | CC1(OCCO1)C2=C(C=C(C=C2)F)Cl |
Computed by PubChem (NCBI)