Products 2918937-80-9
CAS 2918937-80-9 is the registry number for 5-Chloro-2-methyl-3-(methylthio)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-chloro-2-methyl-3-methylsulfanylbenzoic acid (CAS 2918937-80-9) is a chemical compound with the molecular formula C9H9ClO2S and a molecular weight of 216.68 g/mol. IUPAC name: 5-chloro-2-methyl-3-methylsulfanylbenzoic acid. InChIKey: IYAJYHUROIMJDV-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO2S |
|---|---|
| Molecular weight | 216.68 g/mol |
| IUPAC name | 5-chloro-2-methyl-3-methylsulfanylbenzoic acid |
| InChIKey | IYAJYHUROIMJDV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1SC)Cl)C(=O)O |
Computed by PubChem (NCBI)