Products 2918965-29-2
CAS 2918965-29-2 is the registry number for 2-(3,6-Difluoro-2-iodophenyl)-1,3-dioxolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(3,6-difluoro-2-iodophenyl)-1,3-dioxolane (CAS 2918965-29-2) is a chemical compound with the molecular formula C9H7F2IO2 and a molecular weight of 312.05 g/mol. IUPAC name: 2-(3,6-difluoro-2-iodophenyl)-1,3-dioxolane. InChIKey: WSXHXUKZEOEHSC-UHFFFAOYSA-N.
| Molecular formula | C9H7F2IO2 |
|---|---|
| Molecular weight | 312.05 g/mol |
| IUPAC name | 2-(3,6-difluoro-2-iodophenyl)-1,3-dioxolane |
| InChIKey | WSXHXUKZEOEHSC-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=CC(=C2I)F)F |
Computed by PubChem (NCBI)