CAS 885590-98-7 appears in our catalog under these names: 2-(2,3-Difluoro-4-iodophenyl)[1,3]dioxolane, 95%, 2-(2,3-Difluoro-4-iodophenyl)-1,3-dioxolane, 98%, 2-(2,3-Difluoro-4-iodophenyl)[1,3]dioxolane. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-(2,3-difluoro-4-iodophenyl)-1,3-dioxolane (CAS 885590-98-7) is a chemical compound with the molecular formula C9H7F2IO2 and a molecular weight of 312.05 g/mol. IUPAC name: 2-(2,3-difluoro-4-iodophenyl)-1,3-dioxolane. InChIKey: AMBAWEYGYCGAIK-UHFFFAOYSA-N.
| Molecular formula | C9H7F2IO2 |
|---|---|
| Molecular weight | 312.05 g/mol |
| IUPAC name | 2-(2,3-difluoro-4-iodophenyl)-1,3-dioxolane |
| InChIKey | AMBAWEYGYCGAIK-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C(=C(C=C2)I)F)F |
Computed by PubChem (NCBI)