CAS 357166-63-3 appears in our catalog under these names: 2-(3,5-Difluoro-4-iodophenyl)-1,3-dioxolane, 95%, 2-(3,5-Difluoro-4-iodophenyl)-1,3-dioxolane, 98%, 2-(3,5-Difluoro-4-iodophenyl)-1,3-dioxolane. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
2-(3,5-difluoro-4-iodophenyl)-1,3-dioxolane (CAS 357166-63-3) is a chemical compound with the molecular formula C9H7F2IO2 and a molecular weight of 312.05 g/mol. IUPAC name: 2-(3,5-difluoro-4-iodophenyl)-1,3-dioxolane. InChIKey: XQXKFUCGVNEJCS-UHFFFAOYSA-N.
| Molecular formula | C9H7F2IO2 |
|---|---|
| Molecular weight | 312.05 g/mol |
| IUPAC name | 2-(3,5-difluoro-4-iodophenyl)-1,3-dioxolane |
| InChIKey | XQXKFUCGVNEJCS-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=C(C(=C2)F)I)F |
Computed by PubChem (NCBI)