CAS 479090-49-8 is the registry number for 2,5–Difluoro–4–iodo–3–methyl–benzoic acid methyl ester. Offered by: GLPBio. Available pack sizes: 1g.
Methyl 2,5-difluoro-4-iodo-3-methylbenzoate (CAS 479090-49-8) is a chemical compound with the molecular formula C9H7F2IO2 and a molecular weight of 312.05 g/mol. IUPAC name: methyl 2,5-difluoro-4-iodo-3-methylbenzoate. InChIKey: MMIBPPYLNMFCIY-UHFFFAOYSA-N.
| Molecular formula | C9H7F2IO2 |
|---|---|
| Molecular weight | 312.05 g/mol |
| IUPAC name | methyl 2,5-difluoro-4-iodo-3-methylbenzoate |
| InChIKey | MMIBPPYLNMFCIY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1I)F)C(=O)OC)F |
Computed by PubChem (NCBI)