Products 2919097-41-7
CAS 2919097-41-7 is the registry number for Ethyl 2-(2-chloropyridin-4-yl)-3-methylbutanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(2-chloro-4-pyridinyl)-3-methylbutanoate (CAS 2919097-41-7) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: ethyl 2-(2-chloro-4-pyridinyl)-3-methylbutanoate. InChIKey: MKWJKCRKSBZUDJ-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | ethyl 2-(2-chloro-4-pyridinyl)-3-methylbutanoate |
| InChIKey | MKWJKCRKSBZUDJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC(=NC=C1)Cl)C(C)C |
Computed by PubChem (NCBI)