Products 2919323-80-9
CAS 2919323-80-9 is the registry number for 2-Amino-6-fluoro-5,6,8,9-tetrahydro-7H-benzo[7]annulen-7-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-6-fluoro-5,6,8,9-tetrahydrobenzo[7]annulen-7-one (CAS 2919323-80-9) is a chemical compound with the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. IUPAC name: 2-amino-6-fluoro-5,6,8,9-tetrahydrobenzo[7]annulen-7-one. InChIKey: SXSJCZLYFSLHQK-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 2-amino-6-fluoro-5,6,8,9-tetrahydrobenzo[7]annulen-7-one |
| InChIKey | SXSJCZLYFSLHQK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C(CC2=C1C=C(C=C2)N)F |
Computed by PubChem (NCBI)