Products 2919560-42-0
CAS 2919560-42-0 is the registry number for 8-Chloro-1H-pyrano[3,4-c]pyridin-4(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-1H-pyrano[3,4-c]pyridin-4-one (CAS 2919560-42-0) is a chemical compound with the molecular formula C8H6ClNO2 and a molecular weight of 183.59 g/mol. IUPAC name: 8-chloro-1H-pyrano[3,4-c]pyridin-4-one. InChIKey: AUTRLONAZXVANW-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2 |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | 8-chloro-1H-pyrano[3,4-c]pyridin-4-one |
| InChIKey | AUTRLONAZXVANW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CN=C2Cl)C(=O)CO1 |
Computed by PubChem (NCBI)