Products 2920166-26-1
CAS 2920166-26-1 is the registry number for Ammonium 1,4-dihydroxy-2-naphthoate, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
Azanium 2-carboxy-4-hydroxynaphthalen-1-olate (CAS 2920166-26-1) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: azanium 2-carboxy-4-hydroxynaphthalen-1-olate. InChIKey: WIASFSYIHNRGNJ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | azanium 2-carboxy-4-hydroxynaphthalen-1-olate |
| InChIKey | WIASFSYIHNRGNJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=C2[O-])C(=O)O)O.[NH4+] |
Computed by PubChem (NCBI)
Synonyms:
Ammonium 1,4-dihydroxy-2-naphthoate