Products 2920333-49-7
CAS 2920333-49-7 is the registry number for rel-(1S,1AS,6bR)-5-fluoro-1a,6b-dihydro-1H-cyclopropa[b]benzofuran-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,1aS,6bR)-5-fluoro-1a,6b-dihydro-1H-cyclopropa[b][1]benzofuran-1-carboxylic acid (CAS 2920333-49-7) is a chemical compound with the molecular formula C10H7FO3 and a molecular weight of 194.16 g/mol. IUPAC name: (1S,1aS,6bR)-5-fluoro-1a,6b-dihydro-1H-cyclopropa[b][1]benzofuran-1-carboxylic acid. InChIKey: OPUCPJDTLGICHB-CIUDSAMLSA-N.
| Molecular formula | C10H7FO3 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | (1S,1aS,6bR)-5-fluoro-1a,6b-dihydro-1H-cyclopropa[b][1]benzofuran-1-carboxylic acid |
| InChIKey | OPUCPJDTLGICHB-CIUDSAMLSA-N |
| SMILES | C1=CC2=C(C=C1F)[C@H]3[C@@H]([C@H]3O2)C(=O)O |
Computed by PubChem (NCBI)