CAS 58586-70-2 appears in our catalog under these names: (3-Fluoro-4-methoxy-phenyl)-propynoic acid, 98%, 3-(3-Fluoro-4-methoxyphenyl)propiolic acid, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
3-(3-fluoro-4-methoxyphenyl)prop-2-ynoic acid (CAS 58586-70-2) is a chemical compound with the molecular formula C10H7FO3 and a molecular weight of 194.16 g/mol. IUPAC name: 3-(3-fluoro-4-methoxyphenyl)prop-2-ynoic acid. InChIKey: WHPIWKDLBCPGFE-UHFFFAOYSA-N.
| Molecular formula | C10H7FO3 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | 3-(3-fluoro-4-methoxyphenyl)prop-2-ynoic acid |
| InChIKey | WHPIWKDLBCPGFE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C#CC(=O)O)F |
Computed by PubChem (NCBI)