Products 777-15-1
CAS 777-15-1 is the registry number for (2E)-4-(4-Fluorophenyl)-4-oxobut-2-enoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(E)-4-(4-fluorophenyl)-4-oxobut-2-enoic acid (CAS 777-15-1) is a chemical compound with the molecular formula C10H7FO3 and a molecular weight of 194.16 g/mol. IUPAC name: (E)-4-(4-fluorophenyl)-4-oxobut-2-enoic acid. InChIKey: CMSWGWOQRTZZAS-AATRIKPKSA-N.
| Molecular formula | C10H7FO3 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | (E)-4-(4-fluorophenyl)-4-oxobut-2-enoic acid |
| InChIKey | CMSWGWOQRTZZAS-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1C(=O)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
(2E)-4-(4-fluorophenyl)-4-oxobut-2-enoic acid, (2E)-4-(4-Fluorophenyl)-4-oxo-2-butenoic acid, (E)-4-(4-fluorophenyl)-4-oxobut-2-enoic acid, (E)-4-(4-Fluorophenyl)-4-oxo-2-butenoic acid, 4-(4-fluorophenyl)-4-oxobut-2-enoic acid, Z-4-(4-Fluoro-phenyl)-4-oxo-but-2-enoic acid, 2-butenoic acid, 4-(4-fluorophenyl)-4-oxo-, (2E)-, 4-(4-fluoro-phenyl)-4-oxo-but-2-enoic acid, Acide (E)4-(4-fluorophenyl)-4-oxo 2-butenique [French], Acide (E)4-(4-fluorophenyl)-4-oxo 2-butenique