CAS 35504-85-9 appears in our catalog under these names: (E)–4–(4–Fluorophenyl)–4–oxobut–2–enoic acid, (E)-4-(4-Fluorophenyl)-4-oxobut-2-enoic acid 97%, (2E)-4-(4-Fluorophenyl)-4-oxo-2-butenoic acid, 97%, 97%, (E)-4-(4-Fluorophenyl)-4-oxobut-2-enoic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(E)-4-(4-fluorophenyl)-4-oxobut-2-enoic acid (CAS 35504-85-9) is a chemical compound with the molecular formula C10H7FO3 and a molecular weight of 194.16 g/mol. IUPAC name: (E)-4-(4-fluorophenyl)-4-oxobut-2-enoic acid. InChIKey: CMSWGWOQRTZZAS-AATRIKPKSA-N.
| Molecular formula | C10H7FO3 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | (E)-4-(4-fluorophenyl)-4-oxobut-2-enoic acid |
| InChIKey | CMSWGWOQRTZZAS-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1C(=O)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)