CAS 344287-24-7 appears in our catalog under these names: 4-Fluoro-3-methylbenzofuran-2-carboxylic acid, 95+%, 4-fluoro-3-methyl-benzofuran-2-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
4-fluoro-3-methyl-1-benzofuran-2-carboxylic acid (CAS 344287-24-7) is a chemical compound with the molecular formula C10H7FO3 and a molecular weight of 194.16 g/mol. IUPAC name: 4-fluoro-3-methyl-1-benzofuran-2-carboxylic acid. InChIKey: RJFMKOMFFWXGDS-UHFFFAOYSA-N.
| Molecular formula | C10H7FO3 |
|---|---|
| Molecular weight | 194.16 g/mol |
| IUPAC name | 4-fluoro-3-methyl-1-benzofuran-2-carboxylic acid |
| InChIKey | RJFMKOMFFWXGDS-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C1C(=CC=C2)F)C(=O)O |
Computed by PubChem (NCBI)