Products 292160-91-9
CAS 292160-91-9 is the registry number for 4-((3,4-dimethoxyphenyl)methylene)-3-methyl-1-phenyl-2-pyrazolin-5-one. Offered by: Biosynth. Available pack sizes: 250mg.
(4E)-4-[(3,4-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one (CAS 292160-91-9) is a chemical compound with the molecular formula C19H18N2O3 and a molecular weight of 322.4 g/mol. IUPAC name: (4E)-4-[(3,4-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one. InChIKey: PEDXHPZSFZQYMI-LFIBNONCSA-N.
| Molecular formula | C19H18N2O3 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | (4E)-4-[(3,4-dimethoxyphenyl)methylidene]-5-methyl-2-phenylpyrazol-3-one |
| InChIKey | PEDXHPZSFZQYMI-LFIBNONCSA-N |
| SMILES | CC\1=NN(C(=O)/C1=C/C2=CC(=C(C=C2)OC)OC)C3=CC=CC=C3 |
Computed by PubChem (NCBI)