Products 2923009-45-2
CAS 2923009-45-2 appears in our catalog under these names: WRN inhibitor 4, WRN inhibitor 4, 99.40%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10 mg, 1 mg, 25 mg, 5 mg.
N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-5-hydroxy-2-oxo-6-phenyl-1H-pyridine-3-carboxamide (CAS 2923009-45-2) is a chemical compound with the molecular formula C16H14N2O5S and a molecular weight of 346.4 g/mol. IUPAC name: N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-5-hydroxy-2-oxo-6-phenyl-1H-pyridine-3-carboxamide. InChIKey: HFIIQCVNTGZNPC-LLVKDONJSA-N.
| Molecular formula | C16H14N2O5S |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | N-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-5-hydroxy-2-oxo-6-phenyl-1H-pyridine-3-carboxamide |
| InChIKey | HFIIQCVNTGZNPC-LLVKDONJSA-N |
| SMILES | C1[C@@H](C=CS1(=O)=O)NC(=O)C2=CC(=C(NC2=O)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)
Synonyms:
WRN inhibitor 4, orb1943990