CAS 397245-05-5 is the registry number for 7-{[(4-Methoxyphenyl)sulfonyl]amino}-1H-indole-2-carboxylic acid, 95%. Offered by: Fluorochem. Available pack sizes: 1g.
7-[(4-methoxyphenyl)sulfonylamino]-1H-indole-2-carboxylic acid (CAS 397245-05-5) is a chemical compound with the molecular formula C16H14N2O5S and a molecular weight of 346.4 g/mol. IUPAC name: 7-[(4-methoxyphenyl)sulfonylamino]-1H-indole-2-carboxylic acid. InChIKey: UJHWOZFZLVVMIX-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O5S |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 7-[(4-methoxyphenyl)sulfonylamino]-1H-indole-2-carboxylic acid |
| InChIKey | UJHWOZFZLVVMIX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC3=C2NC(=C3)C(=O)O |
Computed by PubChem (NCBI)