Products 397245-05-5

CAS 397245-05-5 is the registry number for 7-{[(4-Methoxyphenyl)sulfonyl]amino}-1H-indole-2-carboxylic acid, 95%. Offered by: Fluorochem. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

7-[(4-methoxyphenyl)sulfonylamino]-1H-indole-2-carboxylic acid (CAS 397245-05-5) is a chemical compound with the molecular formula C16H14N2O5S and a molecular weight of 346.4 g/mol. IUPAC name: 7-[(4-methoxyphenyl)sulfonylamino]-1H-indole-2-carboxylic acid. InChIKey: UJHWOZFZLVVMIX-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14N2O5S
Molecular weight346.4 g/mol
IUPAC name7-[(4-methoxyphenyl)sulfonylamino]-1H-indole-2-carboxylic acid
InChIKeyUJHWOZFZLVVMIX-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC3=C2NC(=C3)C(=O)O

Computed by PubChem (NCBI)