CAS 407582-49-4 appears in our catalog under these names: Febuxostat 67M-4, Febuxostat Metabolite 67M-4. Offered by: TRC, Biosynth, Chemat Brand. Available pack sizes: 10mg, 25mg, 5mg, 100mg, 50mg, on request.
2-[4-(2-carboxypropoxy)-3-cyanophenyl]-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 407582-49-4) is a chemical compound with the molecular formula C16H14N2O5S and a molecular weight of 346.4 g/mol. IUPAC name: 2-[4-(2-carboxypropoxy)-3-cyanophenyl]-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: LCBACLAPKJRMIF-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O5S |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 2-[4-(2-carboxypropoxy)-3-cyanophenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | LCBACLAPKJRMIF-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=C(C=C2)OCC(C)C(=O)O)C#N)C(=O)O |
Computed by PubChem (NCBI)