CAS 52373-92-9 is the registry number for 1-Amino-4-(ethylamino)-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-amino-4-(ethylamino)-9,10-dioxoanthracene-2-sulfonic acid (CAS 52373-92-9) is a chemical compound with the molecular formula C16H14N2O5S and a molecular weight of 346.4 g/mol. IUPAC name: 1-amino-4-(ethylamino)-9,10-dioxoanthracene-2-sulfonic acid. InChIKey: FEDBOBXSLKRGIS-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O5S |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 1-amino-4-(ethylamino)-9,10-dioxoanthracene-2-sulfonic acid |
| InChIKey | FEDBOBXSLKRGIS-UHFFFAOYSA-N |
| SMILES | CCNC1=CC(=C(C2=C1C(=O)C3=CC=CC=C3C2=O)N)S(=O)(=O)O |
Computed by PubChem (NCBI)