Products 2923661-84-9
CAS 2923661-84-9 is the registry number for Amakusamine. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 5 mg, 10 mg.
4,8-dibromo-5H-[1,3]dioxolo[4,5-f]indole (CAS 2923661-84-9) is a chemical compound with the molecular formula C9H5Br2NO2 and a molecular weight of 318.95 g/mol. IUPAC name: 4,8-dibromo-5H-[1,3]dioxolo[4,5-f]indole. InChIKey: QLFRWAZASAPKSB-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2NO2 |
|---|---|
| Molecular weight | 318.95 g/mol |
| IUPAC name | 4,8-dibromo-5H-[1,3]dioxolo[4,5-f]indole |
| InChIKey | QLFRWAZASAPKSB-UHFFFAOYSA-N |
| SMILES | C1OC2=C(C3=C(C(=C2O1)Br)NC=C3)Br |
Computed by PubChem (NCBI)
Synonyms:
Amakusamine, orb1744463