Products 857809-64-4
CAS 857809-64-4 appears in our catalog under these names: 5,6-Dibromo-1h-indole-3-carboxylic acid, 95%, 5,6-dibromo-1H-indole-3-carboxylic acid, 97%, 5,6-dibromo-1H-indole-3-carboxylic acid/ 97.86% (existing batch purity), 5,6-dibromo-1H-indole-3-carboxylic acid, 5,6-dibromo-1H-indole-3-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, TargetMol, Biosynth, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 5mg, 10mg, 25mg.
5,6-dibromo-1H-indole-3-carboxylic acid (CAS 857809-64-4) is a chemical compound with the molecular formula C9H5Br2NO2 and a molecular weight of 318.95 g/mol. IUPAC name: 5,6-dibromo-1H-indole-3-carboxylic acid. InChIKey: ZUKDDHPPAUVCRA-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2NO2 |
|---|---|
| Molecular weight | 318.95 g/mol |
| IUPAC name | 5,6-dibromo-1H-indole-3-carboxylic acid |
| InChIKey | ZUKDDHPPAUVCRA-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Br)Br)NC=C2C(=O)O |
Computed by PubChem (NCBI)