Products 76443-44-2
CAS 76443-44-2 is the registry number for 5,7-Dibromo-2-methyl-4H-benzo[d][1,3]oxazin-4-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dibromo-2-methyl-3,1-benzoxazin-4-one (CAS 76443-44-2) is a chemical compound with the molecular formula C9H5Br2NO2 and a molecular weight of 318.95 g/mol. IUPAC name: 5,7-dibromo-2-methyl-3,1-benzoxazin-4-one. InChIKey: NETYYUWHWSZITA-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2NO2 |
|---|---|
| Molecular weight | 318.95 g/mol |
| IUPAC name | 5,7-dibromo-2-methyl-3,1-benzoxazin-4-one |
| InChIKey | NETYYUWHWSZITA-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=CC(=C2)Br)Br)C(=O)O1 |
Computed by PubChem (NCBI)