CAS 383132-19-2 is the registry number for 4,7-Dibromo-1h-indole-2-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4,7-dibromo-1H-indole-2-carboxylic acid (CAS 383132-19-2) is a chemical compound with the molecular formula C9H5Br2NO2 and a molecular weight of 318.95 g/mol. IUPAC name: 4,7-dibromo-1H-indole-2-carboxylic acid. InChIKey: MKSGZFBPVWXKDA-UHFFFAOYSA-N.
| Molecular formula | C9H5Br2NO2 |
|---|---|
| Molecular weight | 318.95 g/mol |
| IUPAC name | 4,7-dibromo-1H-indole-2-carboxylic acid |
| InChIKey | MKSGZFBPVWXKDA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Br)C=C(N2)C(=O)O)Br |
Computed by PubChem (NCBI)