CAS 29238-40-2 appears in our catalog under these names: Mexiletine Impurity 6 HCl, 6-Demethyl 4-Methyl Mexiletine Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
1-(2,4-dimethylphenoxy)propan-2-amine;hydrochloride (CAS 29238-40-2) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: 1-(2,4-dimethylphenoxy)propan-2-amine;hydrochloride. InChIKey: IFBOBNZYRQENES-UHFFFAOYSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | 1-(2,4-dimethylphenoxy)propan-2-amine;hydrochloride |
| InChIKey | IFBOBNZYRQENES-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OCC(C)N)C.Cl |
Computed by PubChem (NCBI)