CAS 2923986-27-8 is the registry number for MAT2A-IN-18. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-chloro-1-(2-methyl-3-pyridinyl)-4-(prop-2-ynylamino)quinazolin-2-one (CAS 2923986-27-8) is a chemical compound with the molecular formula C17H13ClN4O and a molecular weight of 324.8 g/mol. IUPAC name: 7-chloro-1-(2-methyl-3-pyridinyl)-4-(prop-2-ynylamino)quinazolin-2-one. InChIKey: LYINXMQVLOEUKA-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN4O |
|---|---|
| Molecular weight | 324.8 g/mol |
| IUPAC name | 7-chloro-1-(2-methyl-3-pyridinyl)-4-(prop-2-ynylamino)quinazolin-2-one |
| InChIKey | LYINXMQVLOEUKA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=N1)N2C3=C(C=CC(=C3)Cl)C(=NC2=O)NCC#C |
Computed by PubChem (NCBI)