CAS 30896-65-2 appears in our catalog under these names: Alprazolam 5-Oxide (1mg/ml in Acetonitrile), Alprazolam 5-Oxide, >95% (HPLC), Alprazolam 5-oxide. Offered by: TRC, Biosynth. Available pack sizes: 1x1ml, 10mg, 5mg, 2mg.
8-chloro-1-methyl-5-oxido-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-ium (CAS 30896-65-2) is a chemical compound with the molecular formula C17H13ClN4O and a molecular weight of 324.8 g/mol. IUPAC name: 8-chloro-1-methyl-5-oxido-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-ium. InChIKey: WHYAIKHHRCPZBI-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN4O |
|---|---|
| Molecular weight | 324.8 g/mol |
| IUPAC name | 8-chloro-1-methyl-5-oxido-6-phenyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-5-ium |
| InChIKey | WHYAIKHHRCPZBI-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C3=C(C=C(C=C3)Cl)C(=[N+](C2)[O-])C4=CC=CC=C4 |
Computed by PubChem (NCBI)