Products 36916-14-0
CAS 36916-14-0 appears in our catalog under these names: Alprazolam 5,6-Epoxide (1mg/ml in Acetonitrile), Alprazolam 5,6-Epoxide. Offered by: TRC, Biosynth. Available pack sizes: 10x1ml, 25mg, 10mg, 5mg, 50mg.
14-chloro-9-methyl-2-phenyl-3-oxa-4,7,8,10-tetrazatetracyclo[9.4.0.02,4.06,10]pentadeca-1(11),6,8,12,14-pentaene (CAS 36916-14-0) is a chemical compound with the molecular formula C17H13ClN4O and a molecular weight of 324.8 g/mol. IUPAC name: 14-chloro-9-methyl-2-phenyl-3-oxa-4,7,8,10-tetrazatetracyclo[9.4.0.02,4.06,10]pentadeca-1(11),6,8,12,14-pentaene. InChIKey: MUTIVUARSOHRRB-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN4O |
|---|---|
| Molecular weight | 324.8 g/mol |
| IUPAC name | 14-chloro-9-methyl-2-phenyl-3-oxa-4,7,8,10-tetrazatetracyclo[9.4.0.02,4.06,10]pentadeca-1(11),6,8,12,14-pentaene |
| InChIKey | MUTIVUARSOHRRB-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C3=C(C=C(C=C3)Cl)C4(N(C2)O4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)