CAS 459137-95-2 is the registry number for 5-Amino-4-(1H-1,3-benzodiazol-2-yl)-1-(4-chlorophenyl)-2,3-dihydro-1H-pyrrol-3-one. Offered by: Biosynth. Available pack sizes: 2g, 1g.
4-(1H-benzimidazol-2-yl)-1-(4-chlorophenyl)-5-imino-2H-pyrrol-3-ol (CAS 459137-95-2) is a chemical compound with the molecular formula C17H13ClN4O and a molecular weight of 324.8 g/mol. IUPAC name: 4-(1H-benzimidazol-2-yl)-1-(4-chlorophenyl)-5-imino-2H-pyrrol-3-ol. InChIKey: NWUWTVDCUDIAHG-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN4O |
|---|---|
| Molecular weight | 324.8 g/mol |
| IUPAC name | 4-(1H-benzimidazol-2-yl)-1-(4-chlorophenyl)-5-imino-2H-pyrrol-3-ol |
| InChIKey | NWUWTVDCUDIAHG-UHFFFAOYSA-N |
| SMILES | C1C(=C(C(=N)N1C2=CC=C(C=C2)Cl)C3=NC4=CC=CC=C4N3)O |
Computed by PubChem (NCBI)