CAS 2925067-46-3 is the registry number for (2R,3R)-3-Fluoropyrrolidine-2-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 100mg.
(2R,3R)-3-fluoropyrrolidine-2-carboxylic acid;hydrochloride (CAS 2925067-46-3) is a chemical compound with the molecular formula C5H9ClFNO2 and a molecular weight of 169.58 g/mol. IUPAC name: (2R,3R)-3-fluoropyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: KGIQRHPCRWOMBA-HJXLNUONSA-N.
| Molecular formula | C5H9ClFNO2 |
|---|---|
| Molecular weight | 169.58 g/mol |
| IUPAC name | (2R,3R)-3-fluoropyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | KGIQRHPCRWOMBA-HJXLNUONSA-N |
| SMILES | C1CN[C@@H]([C@@H]1F)C(=O)O.Cl |
Computed by PubChem (NCBI)