CAS 1143504-73-7 appears in our catalog under these names: (2R,4S)-4-Fluoropyrrolidine-2-carboxylic acid hydrochloride, 95%, (2R,4S)–4–Fluoropyrrolidine–2–carboxylic acid hydrochloride, (2R,4S)-4-Fluoropyrrolidine-2-carboxylic acid hydrochloride, H-trans-4-F-D-Pro-OH HCl 95%, (2R,4S)-4-Fluoropyrrolidine-2-carboxylic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 1g, 25g, 100mg, 0,25g, 0,5g, 2g.
(2R,4S)-4-fluoropyrrolidine-2-carboxylic acid;hydrochloride (CAS 1143504-73-7) is a chemical compound with the molecular formula C5H9ClFNO2 and a molecular weight of 169.58 g/mol. IUPAC name: (2R,4S)-4-fluoropyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: UCWWFZQRLUCRFQ-RFKZQXLXSA-N.
| Molecular formula | C5H9ClFNO2 |
|---|---|
| Molecular weight | 169.58 g/mol |
| IUPAC name | (2R,4S)-4-fluoropyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | UCWWFZQRLUCRFQ-RFKZQXLXSA-N |
| SMILES | C1[C@@H](CN[C@H]1C(=O)O)F.Cl |
Computed by PubChem (NCBI)