Products 1648910-82-0

CAS 1648910-82-0 is the registry number for trans-4-Fluoropyrrolidine-2-carboxylic acid hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g, 25g.

Structural formula: {0} (CAS {1})

4-fluoropyrrolidine-2-carboxylic acid;hydrochloride (CAS 1648910-82-0) is a chemical compound with the molecular formula C5H9ClFNO2 and a molecular weight of 169.58 g/mol. IUPAC name: 4-fluoropyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: UCWWFZQRLUCRFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC5H9ClFNO2
Molecular weight169.58 g/mol
IUPAC name4-fluoropyrrolidine-2-carboxylic acid;hydrochloride
InChIKeyUCWWFZQRLUCRFQ-UHFFFAOYSA-N
SMILESC1C(CNC1C(=O)O)F.Cl

Computed by PubChem (NCBI)