Products 2089671-48-5

CAS 2089671-48-5 is the registry number for (R)-3-Fluoropyrrolidine-3-carboxylic acid hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

(3R)-3-fluoropyrrolidine-3-carboxylic acid;hydrochloride (CAS 2089671-48-5) is a chemical compound with the molecular formula C5H9ClFNO2 and a molecular weight of 169.58 g/mol. IUPAC name: (3R)-3-fluoropyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: CBGMUBKXUNQNAI-NUBCRITNSA-N.

Identity
Molecular formulaC5H9ClFNO2
Molecular weight169.58 g/mol
IUPAC name(3R)-3-fluoropyrrolidine-3-carboxylic acid;hydrochloride
InChIKeyCBGMUBKXUNQNAI-NUBCRITNSA-N
SMILESC1CNC[C@]1(C(=O)O)F.Cl

Computed by PubChem (NCBI)