CAS 60604-36-6 appears in our catalog under these names: (2S,4R)–4–Fluoropyrrolidine–2–carboxylic acid hydrochloride, H-trans-4-F-Pro-OH·HCl 97%, (2S,4R)-4-Fluoropyrrolidine-2-carboxylic acid hydrochloride, 97%, 97%, (2S,4R)-4-Fluoropyrrolidine-2-carboxylic acid hydrochloride, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100g.
(2S,4R)-4-fluoropyrrolidine-2-carboxylic acid;hydrochloride (CAS 60604-36-6) is a chemical compound with the molecular formula C5H9ClFNO2 and a molecular weight of 169.58 g/mol. IUPAC name: (2S,4R)-4-fluoropyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: UCWWFZQRLUCRFQ-HJXLNUONSA-N.
| Molecular formula | C5H9ClFNO2 |
|---|---|
| Molecular weight | 169.58 g/mol |
| IUPAC name | (2S,4R)-4-fluoropyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | UCWWFZQRLUCRFQ-HJXLNUONSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)F.Cl |
Computed by PubChem (NCBI)