Products 2925075-46-1
CAS 2925075-46-1 is the registry number for CRBN ligand-639. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indazole-4-carboxylic acid (CAS 2925075-46-1) is a chemical compound with the molecular formula C12H10N4O4 and a molecular weight of 274.23 g/mol. IUPAC name: 7-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indazole-4-carboxylic acid. InChIKey: FGFLWUQFLWBKRG-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O4 |
|---|---|
| Molecular weight | 274.23 g/mol |
| IUPAC name | 7-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indazole-4-carboxylic acid |
| InChIKey | FGFLWUQFLWBKRG-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=C3C(=C(C=C2)C(=O)O)C=NN3 |
Computed by PubChem (NCBI)