Products 5855-71-0
CAS 5855-71-0 appears in our catalog under these names: 2,2'-Dinitrobenzidine, 95%, 95%, 2,2'-Dinitrobenzidine, 95+%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-(4-amino-2-nitrophenyl)-3-nitroaniline (CAS 5855-71-0) is a chemical compound with the molecular formula C12H10N4O4 and a molecular weight of 274.23 g/mol. IUPAC name: 4-(4-amino-2-nitrophenyl)-3-nitroaniline. InChIKey: FEJXQZAKAOGYBC-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O4 |
|---|---|
| Molecular weight | 274.23 g/mol |
| IUPAC name | 4-(4-amino-2-nitrophenyl)-3-nitroaniline |
| InChIKey | FEJXQZAKAOGYBC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)[N+](=O)[O-])C2=C(C=C(C=C2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
2,2'-Dinitrobenzidine, 4-(4-amino-2-nitrophenyl)-3-nitroaniline, 2,2'-Dinitro-4,4'-biphenyldiamine, 2,2-Dinitrobenzidine, [1,1'-Biphenyl]-4,4'-diamine, 2,2'-dinitro-, 4,4'-Diamino-2,2'-dinitrobiphenyl, 2,2 inverted exclamation mark -Dinitrobenzidine, 2,2'-Dinitro[1,1'-biphenyl]-4,4'-diamine