CAS 6271-79-0 appears in our catalog under these names: 3,3'-Dinitrobenzidine, 95%, 3,3’-Dinitrobenzidine, 3,3'–Dinitro–(1,1'–biphenyl)–4,4'–diamine, 3,3'-Dinitrobiphenyl-4,4'-diamine, 3,3'-Dinitrobenzidine, >95.0%(HPLC). Offered by: Combi-blocks, TRC, GLPBio, Biosynth, TCI. Available pack sizes: 25g, 1g, 5g, 50g, 250mg, 10g.
4-(4-amino-3-nitrophenyl)-2-nitroaniline (CAS 6271-79-0) is a chemical compound with the molecular formula C12H10N4O4 and a molecular weight of 274.23 g/mol. IUPAC name: 4-(4-amino-3-nitrophenyl)-2-nitroaniline. InChIKey: OCEINMLGYDSKFW-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O4 |
|---|---|
| Molecular weight | 274.23 g/mol |
| IUPAC name | 4-(4-amino-3-nitrophenyl)-2-nitroaniline |
| InChIKey | OCEINMLGYDSKFW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)N)[N+](=O)[O-])[N+](=O)[O-])N |
Computed by PubChem (NCBI)