Products 2986073-26-9
CAS 2986073-26-9 is the registry number for 3-(6-Hydroxy-4-oxobenzo[d][1,2,3]triazin-3(4H)-yl)piperidine-2,6-dione 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg.
3-(6-hydroxy-4-oxo-1,2,3-benzotriazin-3-yl)piperidine-2,6-dione (CAS 2986073-26-9) is a chemical compound with the molecular formula C12H10N4O4 and a molecular weight of 274.23 g/mol. IUPAC name: 3-(6-hydroxy-4-oxo-1,2,3-benzotriazin-3-yl)piperidine-2,6-dione. InChIKey: YUHHJBLIEGZURL-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O4 |
|---|---|
| Molecular weight | 274.23 g/mol |
| IUPAC name | 3-(6-hydroxy-4-oxo-1,2,3-benzotriazin-3-yl)piperidine-2,6-dione |
| InChIKey | YUHHJBLIEGZURL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C=CC(=C3)O)N=N2 |
Computed by PubChem (NCBI)