CAS 2925082-20-6 is the registry number for CRBN ligand-455. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-(2,4-dioxo-1,3-diazinan-1-yl)quinazoline-5-carbaldehyde (CAS 2925082-20-6) is a chemical compound with the molecular formula C13H10N4O3 and a molecular weight of 270.24 g/mol. IUPAC name: 8-(2,4-dioxo-1,3-diazinan-1-yl)quinazoline-5-carbaldehyde. InChIKey: SSXARYSYHKARBK-UHFFFAOYSA-N.
| Molecular formula | C13H10N4O3 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 8-(2,4-dioxo-1,3-diazinan-1-yl)quinazoline-5-carbaldehyde |
| InChIKey | SSXARYSYHKARBK-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=C3C(=C(C=C2)C=O)C=NC=N3 |
Computed by PubChem (NCBI)