Products 2925087-53-0
CAS 2925087-53-0 is the registry number for CRBN ligand-435. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-4-carbaldehyde (CAS 2925087-53-0) is a chemical compound with the molecular formula C13H11N3O3 and a molecular weight of 257.24 g/mol. IUPAC name: 6-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-4-carbaldehyde. InChIKey: ATVSTCJTMKTGDY-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O3 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 6-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-4-carbaldehyde |
| InChIKey | ATVSTCJTMKTGDY-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC(=C3C=CNC3=C2)C=O |
Computed by PubChem (NCBI)